C22H31NO3 — CID 6976911
[3-[(3R)-3-ethyl-1-methyl-2-oxoazepan-3-yl]phenyl] cyclohexanecarboxylate (PubChem CID 6976911) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is [3-[(3R)-3-ethyl-1-methyl-2-oxoazepan-3-yl]phenyl] cyclohexanecarboxylate.
| Compound Name | [3-[(3R)-3-ethyl-1-methyl-2-oxoazepan-3-yl]phenyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 6976911 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | [3-[(3R)-3-ethyl-1-methyl-2-oxoazepan-3-yl]phenyl] cyclohexanecarboxylate |
| SMILES | CC[C@]1(c2cccc(OC(=O)C3CCCCC3)c2)CCCCN(C)C1=O |
| InChI | InChI=1S/C22H31NO3/c1-3-22(14-7-8-15-23(2)21(22)25)18-12-9-13-19(16-18)26-20(24)17-10-5-4-6-11-17/h9,12-13,16-17H,3-8,10-11,14-15H2,1-2H3/t22-/m1/s1 |
| InChIKey | AEJWSFAFCQTJSI-JOCHJYFZSA-N |
| XLogP | 4.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|