About (3-acetylphenyl) 4-(methylcarbamoyl)benzenesulfonate
(3-acetylphenyl) 4-(methylcarbamoyl)benzenesulfonate (PubChem CID 24525642) has the molecular formula C16H15NO5S
and a molecular weight of 333.37 g/mol. Its IUPAC name is (3-acetylphenyl) 4-(methylcarbamoyl)benzenesulfonate.
Molecular Properties
| Compound Name | (3-acetylphenyl) 4-(methylcarbamoyl)benzenesulfonate |
| PubChem CID | 24525642 |
| Molecular Formula | C16H15NO5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | (3-acetylphenyl) 4-(methylcarbamoyl)benzenesulfonate |
| SMILES | CNC(=O)c1ccc(S(=O)(=O)Oc2cccc(C(C)=O)c2)cc1 |
| InChI | InChI=1S/C16H15NO5S/c1-11(18)13-4-3-5-14(10-13)22-23(20,21)15-8-6-12(7-9-15)16(19)17-2/h3-10H,1-2H3,(H,17,19) |
| InChIKey | SVGDHVHIWDVHPA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-acetylphenyl) 4-(methylcarbamoyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetylphenyl) 4-(methylcarbamoyl)benzenesulfonate?
The IUPAC name of (3-acetylphenyl) 4-(methylcarbamoyl)benzenesulfonate (CID 24525642) is (3-acetylphenyl) 4-(methylcarbamoyl)benzenesulfonate.
What is the SMILES notation for (3-acetylphenyl) 4-(methylcarbamoyl)benzenesulfonate?
The canonical SMILES for (3-acetylphenyl) 4-(methylcarbamoyl)benzenesulfonate is CNC(=O)c1ccc(S(=O)(=O)Oc2cccc(C(C)=O)c2)cc1.
What is the InChIKey of (3-acetylphenyl) 4-(methylcarbamoyl)benzenesulfonate?
The InChIKey is SVGDHVHIWDVHPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO5S/c1-11(18)13-4-3-5-14(10-13)22-23(20,21)15-8-6-12(7-9-15)16(19)17-2/h3-10H,1-2H3,(H,17,19).
What are the key properties of (3-acetylphenyl) 4-(methylcarbamoyl)benzenesulfonate?
(3-acetylphenyl) 4-(methylcarbamoyl)benzenesulfonate has a molecular weight of 333.37 g/mol, XLogP of 2.02, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetylphenyl) 4-(methylcarbamoyl)benzenesulfonate is sourced from PubChem (CID 24525642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).