C17H14N2O4S — CID 26526965
(4-cyanophenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate (PubChem CID 26526965) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is (4-cyanophenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate.
| Compound Name | (4-cyanophenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate |
|---|---|
| PubChem CID | 26526965 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (4-cyanophenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)Oc3ccc(C#N)cc3)ccc21 |
| InChI | InChI=1S/C17H14N2O4S/c1-12(20)19-9-8-14-10-16(6-7-17(14)19)24(21,22)23-15-4-2-13(11-18)3-5-15/h2-7,10H,8-9H2,1H3 |
| InChIKey | GJWFKJQKNQMDLA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|