C21H21F2NO4S — CID 57007622
[3-(1-prop-1-enylpiperidine-4-carbonyl)phenyl] 3,5-difluorobenzenesulfonate (PubChem CID 57007622) has the molecular formula C21H21F2NO4S and a molecular weight of 421.47 g/mol. Its IUPAC name is [3-(1-prop-1-enylpiperidine-4-carbonyl)phenyl] 3,5-difluorobenzenesulfonate.
| Compound Name | [3-(1-prop-1-enylpiperidine-4-carbonyl)phenyl] 3,5-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 57007622 |
| Molecular Formula | C21H21F2NO4S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | [3-(1-prop-1-enylpiperidine-4-carbonyl)phenyl] 3,5-difluorobenzenesulfonate |
| SMILES | CC=CN1CCC(C(=O)c2cccc(OS(=O)(=O)c3cc(F)cc(F)c3)c2)CC1 |
| InChI | InChI=1S/C21H21F2NO4S/c1-2-8-24-9-6-15(7-10-24)21(25)16-4-3-5-19(11-16)28-29(26,27)20-13-17(22)12-18(23)14-20/h2-5,8,11-15H,6-7,9-10H2,1H3 |
| InChIKey | PXFXPNMEJAWXDJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|