C24H24F5NO4S — CID 23499246
[3-[1-[(E)-hex-1-enyl]piperidine-4-carbonyl]phenyl] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 23499246) has the molecular formula C24H24F5NO4S and a molecular weight of 517.52 g/mol. Its IUPAC name is [3-[1-[(E)-hex-1-enyl]piperidine-4-carbonyl]phenyl] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [3-[1-[(E)-hex-1-enyl]piperidine-4-carbonyl]phenyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 23499246 |
| Molecular Formula | C24H24F5NO4S |
| Molecular Weight | 517.52 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | [3-[1-[(E)-hex-1-enyl]piperidine-4-carbonyl]phenyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | CCCC/C=C/N1CCC(C(=O)c2cccc(OS(=O)(=O)c3c(F)c(F)c(F)c(F)c3F)c2)CC1 |
| InChI | InChI=1S/C24H24F5NO4S/c1-2-3-4-5-11-30-12-9-15(10-13-30)23(31)16-7-6-8-17(14-16)34-35(32,33)24-21(28)19(26)18(25)20(27)22(24)29/h5-8,11,14-15H,2-4,9-10,12-13H2,1H3/b11-5+ |
| InChIKey | OHMAMXHOJKMDNN-VZUCSPMQSA-N |
| XLogP | 5.75 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|