C24H32N2O2S — CID 21048764
1-[3-[1-(benzenesulfonyl)cyclobutyl]propyl]-4-(4-methylphenyl)piperazine (PubChem CID 21048764) has the molecular formula C24H32N2O2S and a molecular weight of 412.60 g/mol. Its IUPAC name is 1-[3-[1-(benzenesulfonyl)cyclobutyl]propyl]-4-(4-methylphenyl)piperazine.
| Compound Name | 1-[3-[1-(benzenesulfonyl)cyclobutyl]propyl]-4-(4-methylphenyl)piperazine |
|---|---|
| PubChem CID | 21048764 |
| Molecular Formula | C24H32N2O2S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1-[3-[1-(benzenesulfonyl)cyclobutyl]propyl]-4-(4-methylphenyl)piperazine |
| SMILES | Cc1ccc(N2CCN(CCCC3(S(=O)(=O)c4ccccc4)CCC3)CC2)cc1 |
| InChI | InChI=1S/C24H32N2O2S/c1-21-9-11-22(12-10-21)26-19-17-25(18-20-26)16-6-15-24(13-5-14-24)29(27,28)23-7-3-2-4-8-23/h2-4,7-12H,5-6,13-20H2,1H3 |
| InChIKey | MDLDJWUCVHNGAH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|