C26H30FN3O2S — CID 53237216
4-fluoro-N-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]-N-phenylbenzenesulfonamide (PubChem CID 53237216) has the molecular formula C26H30FN3O2S and a molecular weight of 467.61 g/mol. Its IUPAC name is 4-fluoro-N-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]-N-phenylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 53237216 |
| Molecular Formula | C26H30FN3O2S |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 4-fluoro-N-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]-N-phenylbenzenesulfonamide |
| SMILES | Cc1ccc(N2CCN(CCCN(c3ccccc3)S(=O)(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H30FN3O2S/c1-22-8-12-24(13-9-22)29-20-18-28(19-21-29)16-5-17-30(25-6-3-2-4-7-25)33(31,32)26-14-10-23(27)11-15-26/h2-4,6-15H,5,16-21H2,1H3 |
| InChIKey | GJLBXEURXMGZMW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|