C24H34FN5O3S — CID 50807906
2-[N-(dimethylsulfamoyl)-4-methylanilino]-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]acetamide (PubChem CID 50807906) has the molecular formula C24H34FN5O3S and a molecular weight of 491.63 g/mol. Its IUPAC name is 2-[N-(dimethylsulfamoyl)-4-methylanilino]-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]acetamide.
| Compound Name | 2-[N-(dimethylsulfamoyl)-4-methylanilino]-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 50807906 |
| Molecular Formula | C24H34FN5O3S |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 2-[N-(dimethylsulfamoyl)-4-methylanilino]-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]acetamide |
| SMILES | Cc1ccc(N(CC(=O)NCCCN2CCN(c3ccc(F)cc3)CC2)S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C24H34FN5O3S/c1-20-5-9-23(10-6-20)30(34(32,33)27(2)3)19-24(31)26-13-4-14-28-15-17-29(18-16-28)22-11-7-21(25)8-12-22/h5-12H,4,13-19H2,1-3H3,(H,26,31) |
| InChIKey | UPVGBXNZZYHWDS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|