C17H22FN3O4S — CID 53283202
2-[N-(dimethylsulfamoyl)-4-fluoroanilino]-N-[3-(furan-2-yl)propyl]acetamide (PubChem CID 53283202) has the molecular formula C17H22FN3O4S and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-[N-(dimethylsulfamoyl)-4-fluoroanilino]-N-[3-(furan-2-yl)propyl]acetamide.
| Compound Name | 2-[N-(dimethylsulfamoyl)-4-fluoroanilino]-N-[3-(furan-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 53283202 |
| Molecular Formula | C17H22FN3O4S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-[N-(dimethylsulfamoyl)-4-fluoroanilino]-N-[3-(furan-2-yl)propyl]acetamide |
| SMILES | CN(C)S(=O)(=O)N(CC(=O)NCCCc1ccco1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H22FN3O4S/c1-20(2)26(23,24)21(15-9-7-14(18)8-10-15)13-17(22)19-11-3-5-16-6-4-12-25-16/h4,6-10,12H,3,5,11,13H2,1-2H3,(H,19,22) |
| InChIKey | JUBQKJLMEUMFQL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|