C17H23N3O4S — CID 53283301
4-[dimethylsulfamoyl(methyl)amino]-N-[3-(furan-2-yl)propyl]benzamide (PubChem CID 53283301) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 4-[dimethylsulfamoyl(methyl)amino]-N-[3-(furan-2-yl)propyl]benzamide.
| Compound Name | 4-[dimethylsulfamoyl(methyl)amino]-N-[3-(furan-2-yl)propyl]benzamide |
|---|---|
| PubChem CID | 53283301 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-[dimethylsulfamoyl(methyl)amino]-N-[3-(furan-2-yl)propyl]benzamide |
| SMILES | CN(C)S(=O)(=O)N(C)c1ccc(C(=O)NCCCc2ccco2)cc1 |
| InChI | InChI=1S/C17H23N3O4S/c1-19(2)25(22,23)20(3)15-10-8-14(9-11-15)17(21)18-12-4-6-16-7-5-13-24-16/h5,7-11,13H,4,6,12H2,1-3H3,(H,18,21) |
| InChIKey | NEBCUWQQTJCSAC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|