C19H24ClN3O3S — CID 92663766
N-[3-(4-chlorophenyl)propyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide (PubChem CID 92663766) has the molecular formula C19H24ClN3O3S and a molecular weight of 409.94 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)propyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide.
| Compound Name | N-[3-(4-chlorophenyl)propyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide |
|---|---|
| PubChem CID | 92663766 |
| Molecular Formula | C19H24ClN3O3S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-[3-(4-chlorophenyl)propyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide |
| SMILES | CN(C)S(=O)(=O)N(C)c1ccc(C(=O)NCCCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H24ClN3O3S/c1-22(2)27(25,26)23(3)18-12-8-16(9-13-18)19(24)21-14-4-5-15-6-10-17(20)11-7-15/h6-13H,4-5,14H2,1-3H3,(H,21,24) |
| InChIKey | DUKCDNAAFHSKHI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|