C19H23Cl2N3O3S2 — CID 18891232
N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide (PubChem CID 18891232) has the molecular formula C19H23Cl2N3O3S2 and a molecular weight of 476.45 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide.
| Compound Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide |
|---|---|
| PubChem CID | 18891232 |
| Molecular Formula | C19H23Cl2N3O3S2 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide |
| SMILES | CN(C)S(=O)(=O)N(C)c1ccc(C(=O)NCCSCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H23Cl2N3O3S2/c1-23(2)29(26,27)24(3)17-8-5-14(6-9-17)19(25)22-10-11-28-13-15-4-7-16(20)12-18(15)21/h4-9,12H,10-11,13H2,1-3H3,(H,22,25) |
| InChIKey | OORZNPKHLPUXAA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|