C19H24ClN3O3S2 — CID 92664134
N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide (PubChem CID 92664134) has the molecular formula C19H24ClN3O3S2 and a molecular weight of 442.01 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide.
| Compound Name | N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide |
|---|---|
| PubChem CID | 92664134 |
| Molecular Formula | C19H24ClN3O3S2 |
| Molecular Weight | 442.01 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-4-[dimethylsulfamoyl(methyl)amino]benzamide |
| SMILES | CN(C)S(=O)(=O)N(C)c1ccc(C(=O)NCCSCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C19H24ClN3O3S2/c1-22(2)28(25,26)23(3)17-10-8-15(9-11-17)19(24)21-12-13-27-14-16-6-4-5-7-18(16)20/h4-11H,12-14H2,1-3H3,(H,21,24) |
| InChIKey | NLYOHCKNVMZVHQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.01 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|