C19H22Cl2N2O3S2 — CID 2914504
N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(N-methylsulfonylanilino)propanamide (PubChem CID 2914504) has the molecular formula C19H22Cl2N2O3S2 and a molecular weight of 461.44 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(N-methylsulfonylanilino)propanamide.
| Compound Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 2914504 |
| Molecular Formula | C19H22Cl2N2O3S2 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(N-methylsulfonylanilino)propanamide |
| SMILES | CC(C(=O)NCCSCc1ccc(Cl)cc1Cl)N(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C19H22Cl2N2O3S2/c1-14(23(28(2,25)26)17-6-4-3-5-7-17)19(24)22-10-11-27-13-15-8-9-16(20)12-18(15)21/h3-9,12,14H,10-11,13H2,1-2H3,(H,22,24) |
| InChIKey | TVQMCLOZJWFLBU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|