C20H25ClN2O3S2 — CID 132672238
N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-2-(3-methyl-N-methylsulfonylanilino)propanamide (PubChem CID 132672238) has the molecular formula C20H25ClN2O3S2 and a molecular weight of 441.02 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-2-(3-methyl-N-methylsulfonylanilino)propanamide.
| Compound Name | N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-2-(3-methyl-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 132672238 |
| Molecular Formula | C20H25ClN2O3S2 |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-2-(3-methyl-N-methylsulfonylanilino)propanamide |
| SMILES | Cc1cccc(N(C(C)C(=O)NCCSCc2ccccc2Cl)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H25ClN2O3S2/c1-15-7-6-9-18(13-15)23(28(3,25)26)16(2)20(24)22-11-12-27-14-17-8-4-5-10-19(17)21/h4-10,13,16H,11-12,14H2,1-3H3,(H,22,24) |
| InChIKey | OMORGMCGYMMIAO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|