C20H25ClN2O3S2 — CID 126413449
(2S)-2-(4-chloro-N-methylsulfonylanilino)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]propanamide (PubChem CID 126413449) has the molecular formula C20H25ClN2O3S2 and a molecular weight of 441.02 g/mol. Its IUPAC name is (2S)-2-(4-chloro-N-methylsulfonylanilino)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]propanamide.
| Compound Name | (2S)-2-(4-chloro-N-methylsulfonylanilino)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]propanamide |
|---|---|
| PubChem CID | 126413449 |
| Molecular Formula | C20H25ClN2O3S2 |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (2S)-2-(4-chloro-N-methylsulfonylanilino)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]propanamide |
| SMILES | Cc1ccc(CSCCNC(=O)[C@H](C)N(c2ccc(Cl)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H25ClN2O3S2/c1-15-4-6-17(7-5-15)14-27-13-12-22-20(24)16(2)23(28(3,25)26)19-10-8-18(21)9-11-19/h4-11,16H,12-14H2,1-3H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | NAZHIXFPIXSMFH-INIZCTEOSA-N |
| XLogP | 3.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|