C20H25ClN2O3S2 — CID 2232282
(2S)-N-[2-(4-chlorophenyl)sulfanylethyl]-2-(3,5-dimethyl-N-methylsulfonylanilino)propanamide (PubChem CID 2232282) has the molecular formula C20H25ClN2O3S2 and a molecular weight of 441.02 g/mol. Its IUPAC name is (2S)-N-[2-(4-chlorophenyl)sulfanylethyl]-2-(3,5-dimethyl-N-methylsulfonylanilino)propanamide.
| Compound Name | (2S)-N-[2-(4-chlorophenyl)sulfanylethyl]-2-(3,5-dimethyl-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 2232282 |
| Molecular Formula | C20H25ClN2O3S2 |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (2S)-N-[2-(4-chlorophenyl)sulfanylethyl]-2-(3,5-dimethyl-N-methylsulfonylanilino)propanamide |
| SMILES | Cc1cc(C)cc(N([C@@H](C)C(=O)NCCSc2ccc(Cl)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H25ClN2O3S2/c1-14-11-15(2)13-18(12-14)23(28(4,25)26)16(3)20(24)22-9-10-27-19-7-5-17(21)6-8-19/h5-8,11-13,16H,9-10H2,1-4H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | QEXMFWRFZCKYPX-INIZCTEOSA-N |
| XLogP | 4.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|