C22H31N3O5S — CID 92663771
4-[dimethylsulfamoyl(methyl)amino]-N-[3-(4-ethoxy-3-methoxyphenyl)propyl]benzamide (PubChem CID 92663771) has the molecular formula C22H31N3O5S and a molecular weight of 449.57 g/mol. Its IUPAC name is 4-[dimethylsulfamoyl(methyl)amino]-N-[3-(4-ethoxy-3-methoxyphenyl)propyl]benzamide.
| Compound Name | 4-[dimethylsulfamoyl(methyl)amino]-N-[3-(4-ethoxy-3-methoxyphenyl)propyl]benzamide |
|---|---|
| PubChem CID | 92663771 |
| Molecular Formula | C22H31N3O5S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 4-[dimethylsulfamoyl(methyl)amino]-N-[3-(4-ethoxy-3-methoxyphenyl)propyl]benzamide |
| SMILES | CCOc1ccc(CCCNC(=O)c2ccc(N(C)S(=O)(=O)N(C)C)cc2)cc1OC |
| InChI | InChI=1S/C22H31N3O5S/c1-6-30-20-14-9-17(16-21(20)29-5)8-7-15-23-22(26)18-10-12-19(13-11-18)25(4)31(27,28)24(2)3/h9-14,16H,6-8,15H2,1-5H3,(H,23,26) |
| InChIKey | BIFBCODIGYGCQB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|