C17H22FN3O4S2 — CID 92664005
2-[N-(dimethylsulfamoyl)-4-fluoroanilino]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide (PubChem CID 92664005) has the molecular formula C17H22FN3O4S2 and a molecular weight of 415.51 g/mol. Its IUPAC name is 2-[N-(dimethylsulfamoyl)-4-fluoroanilino]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide.
| Compound Name | 2-[N-(dimethylsulfamoyl)-4-fluoroanilino]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 92664005 |
| Molecular Formula | C17H22FN3O4S2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-[N-(dimethylsulfamoyl)-4-fluoroanilino]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide |
| SMILES | CN(C)S(=O)(=O)N(CC(=O)NCCSCc1ccco1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H22FN3O4S2/c1-20(2)27(23,24)21(15-7-5-14(18)6-8-15)12-17(22)19-9-11-26-13-16-4-3-10-25-16/h3-8,10H,9,11-13H2,1-2H3,(H,19,22) |
| InChIKey | DUAAVZYPQGPANQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|