C14H18N2O4S3 — CID 18113796
N-[2-(furan-2-ylmethylsulfanyl)ethyl]-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide (PubChem CID 18113796) has the molecular formula C14H18N2O4S3 and a molecular weight of 374.51 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylsulfanyl)ethyl]-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide.
| Compound Name | N-[2-(furan-2-ylmethylsulfanyl)ethyl]-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 18113796 |
| Molecular Formula | C14H18N2O4S3 |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | N-[2-(furan-2-ylmethylsulfanyl)ethyl]-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
| SMILES | CN(CC(=O)NCCSCc1ccco1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H18N2O4S3/c1-16(23(18,19)14-5-3-8-22-14)10-13(17)15-6-9-21-11-12-4-2-7-20-12/h2-5,7-8H,6,9-11H2,1H3,(H,15,17) |
| InChIKey | NVGZSQDDDGLOIN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|