C20H29N3O4S — CID 175441844
tert-butyl 2-[4-(4-benzyl-3,5-dioxo-1,2,4-thiadiazolidin-2-yl)butyl-methylamino]acetate (PubChem CID 175441844) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is tert-butyl 2-[4-(4-benzyl-3,5-dioxo-1,2,4-thiadiazolidin-2-yl)butyl-methylamino]acetate.
| Compound Name | tert-butyl 2-[4-(4-benzyl-3,5-dioxo-1,2,4-thiadiazolidin-2-yl)butyl-methylamino]acetate |
|---|---|
| PubChem CID | 175441844 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | tert-butyl 2-[4-(4-benzyl-3,5-dioxo-1,2,4-thiadiazolidin-2-yl)butyl-methylamino]acetate |
| SMILES | CN(CCCCn1sc(=O)n(Cc2ccccc2)c1=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29N3O4S/c1-20(2,3)27-17(24)15-21(4)12-8-9-13-23-18(25)22(19(26)28-23)14-16-10-6-5-7-11-16/h5-7,10-11H,8-9,12-15H2,1-4H3 |
| InChIKey | HKCMLCWOAQPXJH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|