C22H37NO3 — CID 53238160
tert-butyl 2-[nonyl(phenylmethoxy)amino]acetate (PubChem CID 53238160) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is tert-butyl 2-[nonyl(phenylmethoxy)amino]acetate.
| Compound Name | tert-butyl 2-[nonyl(phenylmethoxy)amino]acetate |
|---|---|
| PubChem CID | 53238160 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | tert-butyl 2-[nonyl(phenylmethoxy)amino]acetate |
| SMILES | CCCCCCCCCN(CC(=O)OC(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C22H37NO3/c1-5-6-7-8-9-10-14-17-23(18-21(24)26-22(2,3)4)25-19-20-15-12-11-13-16-20/h11-13,15-16H,5-10,14,17-19H2,1-4H3 |
| InChIKey | ZZJIWVODJHUGRA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|