C26H34N2O5 — CID 86744597
tert-butyl 3-oxo-2-[[phenylmethoxy-[4-(phenylmethoxyamino)butyl]amino]methyl]prop-2-enoate (PubChem CID 86744597) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is tert-butyl 3-oxo-2-[[phenylmethoxy-[4-(phenylmethoxyamino)butyl]amino]methyl]prop-2-enoate.
| Compound Name | tert-butyl 3-oxo-2-[[phenylmethoxy-[4-(phenylmethoxyamino)butyl]amino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 86744597 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | tert-butyl 3-oxo-2-[[phenylmethoxy-[4-(phenylmethoxyamino)butyl]amino]methyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)C(=C=O)CN(CCCCNOCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C26H34N2O5/c1-26(2,3)33-25(30)24(19-29)18-28(32-21-23-14-8-5-9-15-23)17-11-10-16-27-31-20-22-12-6-4-7-13-22/h4-9,12-15,27H,10-11,16-18,20-21H2,1-3H3 |
| InChIKey | XAFWXMGVVMVRHB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|