C35H47N3O5 — CID 10627230
N'-phenylmethoxy-N-[5-(phenylmethoxyamino)pentyl]-N'-(5-phenylmethoxypentyl)butanediamide (PubChem CID 10627230) has the molecular formula C35H47N3O5 and a molecular weight of 589.78 g/mol. Its IUPAC name is N'-phenylmethoxy-N-[5-(phenylmethoxyamino)pentyl]-N'-(5-phenylmethoxypentyl)butanediamide.
| Compound Name | N'-phenylmethoxy-N-[5-(phenylmethoxyamino)pentyl]-N'-(5-phenylmethoxypentyl)butanediamide |
|---|---|
| PubChem CID | 10627230 |
| Molecular Formula | C35H47N3O5 |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 589.35 |
| IUPAC Name | N'-phenylmethoxy-N-[5-(phenylmethoxyamino)pentyl]-N'-(5-phenylmethoxypentyl)butanediamide |
| SMILES | O=C(CCC(=O)N(CCCCCOCc1ccccc1)OCc1ccccc1)NCCCCCNOCc1ccccc1 |
| InChI | InChI=1S/C35H47N3O5/c39-34(36-24-12-4-13-25-37-42-29-32-18-8-2-9-19-32)22-23-35(40)38(43-30-33-20-10-3-11-21-33)26-14-5-15-27-41-28-31-16-6-1-7-17-31/h1-3,6-11,16-21,37H,4-5,12-15,22-30H2,(H,36,39) |
| InChIKey | PQCFDXMDJIUNEI-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|