C39H51N3O8 — CID 10532656
4-oxo-4-[5-[[4-oxo-4-[phenylmethoxy(5-phenylmethoxypentyl)amino]butanoyl]amino]pentyl-phenylmethoxyamino]butanoic acid (PubChem CID 10532656) has the molecular formula C39H51N3O8 and a molecular weight of 689.85 g/mol. Its IUPAC name is 4-oxo-4-[5-[[4-oxo-4-[phenylmethoxy(5-phenylmethoxypentyl)amino]butanoyl]amino]pentyl-phenylmethoxyamino]butanoic acid.
| Compound Name | 4-oxo-4-[5-[[4-oxo-4-[phenylmethoxy(5-phenylmethoxypentyl)amino]butanoyl]amino]pentyl-phenylmethoxyamino]butanoic acid |
|---|---|
| PubChem CID | 10532656 |
| Molecular Formula | C39H51N3O8 |
| Molecular Weight | 689.85 g/mol |
| Exact Mass | 689.37 |
| IUPAC Name | 4-oxo-4-[5-[[4-oxo-4-[phenylmethoxy(5-phenylmethoxypentyl)amino]butanoyl]amino]pentyl-phenylmethoxyamino]butanoic acid |
| SMILES | O=C(O)CCC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCOCc1ccccc1)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C39H51N3O8/c43-36(40-26-12-4-13-27-42(38(45)24-25-39(46)47)50-32-35-20-10-3-11-21-35)22-23-37(44)41(49-31-34-18-8-2-9-19-34)28-14-5-15-29-48-30-33-16-6-1-7-17-33/h1-3,6-11,16-21H,4-5,12-15,22-32H2,(H,40,43)(H,46,47) |
| InChIKey | SDALKPPUYFIBKV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.85 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|