C9H8N2O2S — CID 22507205
4-benzyl-1,2,4-thiadiazolidine-3,5-dione (PubChem CID 22507205) has the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. Its IUPAC name is 4-benzyl-1,2,4-thiadiazolidine-3,5-dione.
| Compound Name | 4-benzyl-1,2,4-thiadiazolidine-3,5-dione |
|---|---|
| PubChem CID | 22507205 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 4-benzyl-1,2,4-thiadiazolidine-3,5-dione |
| SMILES | O=c1[nH]sc(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C9H8N2O2S/c12-8-10-14-9(13)11(8)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,10,12) |
| InChIKey | LDGOBWJACIFFFE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |