C14H13Br2N3O2 — CID 98152927
(1S,7R,8S,9R)-4-benzyl-8,9-dibromo-2,4,6-triazatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 98152927) has the molecular formula C14H13Br2N3O2 and a molecular weight of 415.09 g/mol. Its IUPAC name is (1S,7R,8S,9R)-4-benzyl-8,9-dibromo-2,4,6-triazatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,7R,8S,9R)-4-benzyl-8,9-dibromo-2,4,6-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 98152927 |
| Molecular Formula | C14H13Br2N3O2 |
| Molecular Weight | 415.09 g/mol |
| Exact Mass | 412.94 |
| IUPAC Name | (1S,7R,8S,9R)-4-benzyl-8,9-dibromo-2,4,6-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=c1n(Cc2ccccc2)c(=O)n2n1[C@@H]1C[C@H]2[C@@H](Br)[C@H]1Br |
| InChI | InChI=1S/C14H13Br2N3O2/c15-11-9-6-10(12(11)16)19-14(21)17(13(20)18(9)19)7-8-4-2-1-3-5-8/h1-5,9-12H,6-7H2/t9-,10+,11+,12- |
| InChIKey | JNSLTQBHEOJKMD-IWDIQUIJSA-N |
| XLogP | 1.89 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.09 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|