C12H13N3O5 — CID 15495786
1-benzyl-3,5-bis(hydroxymethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 15495786) has the molecular formula C12H13N3O5 and a molecular weight of 279.25 g/mol. Its IUPAC name is 1-benzyl-3,5-bis(hydroxymethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-benzyl-3,5-bis(hydroxymethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 15495786 |
| Molecular Formula | C12H13N3O5 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 1-benzyl-3,5-bis(hydroxymethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(CO)c(=O)n(Cc2ccccc2)c(=O)n1CO |
| InChI | InChI=1S/C12H13N3O5/c16-7-14-10(18)13(6-9-4-2-1-3-5-9)11(19)15(8-17)12(14)20/h1-5,16-17H,6-8H2 |
| InChIKey | PRDCKFTVASQLEL-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |