C11H10N2O5 — CID 91343351
(3-benzyl-4-hydroxy-2-oxoimidazol-1-yl) hydrogen carbonate (PubChem CID 91343351) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is (3-benzyl-4-hydroxy-2-oxoimidazol-1-yl) hydrogen carbonate.
| Compound Name | (3-benzyl-4-hydroxy-2-oxoimidazol-1-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 91343351 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | (3-benzyl-4-hydroxy-2-oxoimidazol-1-yl) hydrogen carbonate |
| SMILES | O=C(O)On1cc(O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C11H10N2O5/c14-9-7-13(18-11(16)17)10(15)12(9)6-8-4-2-1-3-5-8/h1-5,7,14H,6H2,(H,16,17) |
| InChIKey | OXKKBBGCPDZSFC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |