C20H25N3O7S2 — CID 12062948
3-[3-benzyl-2,4,6-trioxo-5-[3-(2-sulfanylacetyl)oxypropyl]-1,3,5-triazinan-1-yl]propyl 2-sulfanylacetate (PubChem CID 12062948) has the molecular formula C20H25N3O7S2 and a molecular weight of 483.57 g/mol. Its IUPAC name is 3-[3-benzyl-2,4,6-trioxo-5-[3-(2-sulfanylacetyl)oxypropyl]-1,3,5-triazinan-1-yl]propyl 2-sulfanylacetate.
| Compound Name | 3-[3-benzyl-2,4,6-trioxo-5-[3-(2-sulfanylacetyl)oxypropyl]-1,3,5-triazinan-1-yl]propyl 2-sulfanylacetate |
|---|---|
| PubChem CID | 12062948 |
| Molecular Formula | C20H25N3O7S2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 3-[3-benzyl-2,4,6-trioxo-5-[3-(2-sulfanylacetyl)oxypropyl]-1,3,5-triazinan-1-yl]propyl 2-sulfanylacetate |
| SMILES | O=C(CS)OCCCn1c(=O)n(CCCOC(=O)CS)c(=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C20H25N3O7S2/c24-16(13-31)29-10-4-8-21-18(26)22(9-5-11-30-17(25)14-32)20(28)23(19(21)27)12-15-6-2-1-3-7-15/h1-3,6-7,31-32H,4-5,8-14H2 |
| InChIKey | AKJQLNUXGFEBIO-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|