C20H18N2O3 — CID 131848742
6-acetyl-1,3-dibenzylpyrimidine-2,4-dione (PubChem CID 131848742) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 6-acetyl-1,3-dibenzylpyrimidine-2,4-dione.
| Compound Name | 6-acetyl-1,3-dibenzylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 131848742 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 6-acetyl-1,3-dibenzylpyrimidine-2,4-dione |
| SMILES | CC(=O)c1cc(=O)n(Cc2ccccc2)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H18N2O3/c1-15(23)18-12-19(24)22(14-17-10-6-3-7-11-17)20(25)21(18)13-16-8-4-2-5-9-16/h2-12H,13-14H2,1H3 |
| InChIKey | MTLGSPDFACWYLD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |