C15H11Cl2N3O — CID 146171822
1-(7-benzyl-2,4-dichloropyrrolo[2,3-d]pyrimidin-6-yl)ethanone (PubChem CID 146171822) has the molecular formula C15H11Cl2N3O and a molecular weight of 320.18 g/mol. Its IUPAC name is 1-(7-benzyl-2,4-dichloropyrrolo[2,3-d]pyrimidin-6-yl)ethanone.
| Compound Name | 1-(7-benzyl-2,4-dichloropyrrolo[2,3-d]pyrimidin-6-yl)ethanone |
|---|---|
| PubChem CID | 146171822 |
| Molecular Formula | C15H11Cl2N3O |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 1-(7-benzyl-2,4-dichloropyrrolo[2,3-d]pyrimidin-6-yl)ethanone |
| SMILES | CC(=O)c1cc2c(Cl)nc(Cl)nc2n1Cc1ccccc1 |
| InChI | InChI=1S/C15H11Cl2N3O/c1-9(21)12-7-11-13(16)18-15(17)19-14(11)20(12)8-10-5-3-2-4-6-10/h2-7H,8H2,1H3 |
| InChIKey | CJWZYGFETBTABI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |