C12H8Cl3NO — CID 121014546
1-benzyl-4,5-dichloropyrrole-2-carbonyl chloride (PubChem CID 121014546) has the molecular formula C12H8Cl3NO and a molecular weight of 288.56 g/mol. Its IUPAC name is 1-benzyl-4,5-dichloropyrrole-2-carbonyl chloride.
| Compound Name | 1-benzyl-4,5-dichloropyrrole-2-carbonyl chloride |
|---|---|
| PubChem CID | 121014546 |
| Molecular Formula | C12H8Cl3NO |
| Molecular Weight | 288.56 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | 1-benzyl-4,5-dichloropyrrole-2-carbonyl chloride |
| SMILES | O=C(Cl)c1cc(Cl)c(Cl)n1Cc1ccccc1 |
| InChI | InChI=1S/C12H8Cl3NO/c13-9-6-10(12(15)17)16(11(9)14)7-8-4-2-1-3-5-8/h1-6H,7H2 |
| InChIKey | ZTKOZJHKGIZRNX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|