C14H12Cl3NO — CID 159329355
2,4-dichlorobenzoyl chloride;phenylmethanamine (PubChem CID 159329355) has the molecular formula C14H12Cl3NO and a molecular weight of 316.62 g/mol. Its IUPAC name is 2,4-dichlorobenzoyl chloride;phenylmethanamine.
| Compound Name | 2,4-dichlorobenzoyl chloride;phenylmethanamine |
|---|---|
| PubChem CID | 159329355 |
| Molecular Formula | C14H12Cl3NO |
| Molecular Weight | 316.62 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 2,4-dichlorobenzoyl chloride;phenylmethanamine |
| SMILES | NCc1ccccc1.O=C(Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H3Cl3O.C7H9N/c8-4-1-2-5(7(10)11)6(9)3-4;8-6-7-4-2-1-3-5-7/h1-3H;1-5H,6,8H2 |
| InChIKey | LETWBASYKXSZER-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|