About bis(4-chlorophenol);phenylmethanamine
bis(4-chlorophenol);phenylmethanamine (PubChem CID 70600603) has the molecular formula C19H19Cl2NO2
and a molecular weight of 364.27 g/mol. Its IUPAC name is bis(4-chlorophenol);phenylmethanamine.
Molecular Properties
| Compound Name | bis(4-chlorophenol);phenylmethanamine |
| PubChem CID | 70600603 |
| Molecular Formula | C19H19Cl2NO2 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | bis(4-chlorophenol);phenylmethanamine |
| SMILES | NCc1ccccc1.Oc1ccc(Cl)cc1.Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H9N.2C6H5ClO/c8-6-7-4-2-1-3-5-7;2*7-5-1-3-6(8)4-2-5/h1-5H,6,8H2;2*1-4,8H |
| InChIKey | KPIIMLDPCCQSPV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(4-chlorophenol);phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-chlorophenol);phenylmethanamine?
The IUPAC name of bis(4-chlorophenol);phenylmethanamine (CID 70600603) is bis(4-chlorophenol);phenylmethanamine.
What is the SMILES notation for bis(4-chlorophenol);phenylmethanamine?
The canonical SMILES for bis(4-chlorophenol);phenylmethanamine is NCc1ccccc1.Oc1ccc(Cl)cc1.Oc1ccc(Cl)cc1.
What is the InChIKey of bis(4-chlorophenol);phenylmethanamine?
The InChIKey is KPIIMLDPCCQSPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.2C6H5ClO/c8-6-7-4-2-1-3-5-7;2*7-5-1-3-6(8)4-2-5/h1-5H,6,8H2;2*1-4,8H.
What are the key properties of bis(4-chlorophenol);phenylmethanamine?
bis(4-chlorophenol);phenylmethanamine has a molecular weight of 364.27 g/mol, XLogP of 5.24, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-chlorophenol);phenylmethanamine is sourced from PubChem (CID 70600603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).