About naphthalene-2,6-diol;phenylmethanamine
naphthalene-2,6-diol;phenylmethanamine (PubChem CID 139184911) has the molecular formula C24H26N2O2
and a molecular weight of 374.48 g/mol. Its IUPAC name is naphthalene-2,6-diol;phenylmethanamine.
Molecular Properties
| Compound Name | naphthalene-2,6-diol;phenylmethanamine |
| PubChem CID | 139184911 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | naphthalene-2,6-diol;phenylmethanamine |
| SMILES | NCc1ccccc1.NCc1ccccc1.Oc1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C10H8O2.2C7H9N/c11-9-3-1-7-5-10(12)4-2-8(7)6-9;2*8-6-7-4-2-1-3-5-7/h1-6,11-12H;2*1-5H,6,8H2 |
| InChIKey | VXPWTSQZFQSIJL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze naphthalene-2,6-diol;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-2,6-diol;phenylmethanamine?
The IUPAC name of naphthalene-2,6-diol;phenylmethanamine (CID 139184911) is naphthalene-2,6-diol;phenylmethanamine.
What is the SMILES notation for naphthalene-2,6-diol;phenylmethanamine?
The canonical SMILES for naphthalene-2,6-diol;phenylmethanamine is NCc1ccccc1.NCc1ccccc1.Oc1ccc2cc(O)ccc2c1.
What is the InChIKey of naphthalene-2,6-diol;phenylmethanamine?
The InChIKey is VXPWTSQZFQSIJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2.2C7H9N/c11-9-3-1-7-5-10(12)4-2-8(7)6-9;2*8-6-7-4-2-1-3-5-7/h1-6,11-12H;2*1-5H,6,8H2.
What are the key properties of naphthalene-2,6-diol;phenylmethanamine?
naphthalene-2,6-diol;phenylmethanamine has a molecular weight of 374.48 g/mol, XLogP of 4.54, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-2,6-diol;phenylmethanamine is sourced from PubChem (CID 139184911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).