About naphthalen-2-amine;phenylmethanamine
naphthalen-2-amine;phenylmethanamine (PubChem CID 174814496) has the molecular formula C17H18N2
and a molecular weight of 250.34 g/mol. Its IUPAC name is naphthalen-2-amine;phenylmethanamine.
Molecular Properties
| Compound Name | naphthalen-2-amine;phenylmethanamine |
| PubChem CID | 174814496 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | naphthalen-2-amine;phenylmethanamine |
| SMILES | NCc1ccccc1.Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H9N.C7H9N/c11-10-6-5-8-3-1-2-4-9(8)7-10;8-6-7-4-2-1-3-5-7/h1-7H,11H2;1-5H,6,8H2 |
| InChIKey | GXZWBKHXUHPXKL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-amine;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-amine;phenylmethanamine?
The IUPAC name of naphthalen-2-amine;phenylmethanamine (CID 174814496) is naphthalen-2-amine;phenylmethanamine.
What is the SMILES notation for naphthalen-2-amine;phenylmethanamine?
The canonical SMILES for naphthalen-2-amine;phenylmethanamine is NCc1ccccc1.Nc1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-amine;phenylmethanamine?
The InChIKey is GXZWBKHXUHPXKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C7H9N/c11-10-6-5-8-3-1-2-4-9(8)7-10;8-6-7-4-2-1-3-5-7/h1-7H,11H2;1-5H,6,8H2.
What are the key properties of naphthalen-2-amine;phenylmethanamine?
naphthalen-2-amine;phenylmethanamine has a molecular weight of 250.34 g/mol, XLogP of 3.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-amine;phenylmethanamine is sourced from PubChem (CID 174814496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).