About anisole;naphthalen-2-amine
anisole;naphthalen-2-amine (PubChem CID 159214665) has the molecular formula C17H17NO
and a molecular weight of 251.33 g/mol. Its IUPAC name is anisole;naphthalen-2-amine.
Molecular Properties
| Compound Name | anisole;naphthalen-2-amine |
| PubChem CID | 159214665 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | anisole;naphthalen-2-amine |
| SMILES | COc1ccccc1.Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H9N.C7H8O/c11-10-6-5-8-3-1-2-4-9(8)7-10;1-8-7-5-3-2-4-6-7/h1-7H,11H2;2-6H,1H3 |
| InChIKey | KQXLOQFAKYVPEZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze anisole;naphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;naphthalen-2-amine?
The IUPAC name of anisole;naphthalen-2-amine (CID 159214665) is anisole;naphthalen-2-amine.
What is the SMILES notation for anisole;naphthalen-2-amine?
The canonical SMILES for anisole;naphthalen-2-amine is COc1ccccc1.Nc1ccc2ccccc2c1.
What is the InChIKey of anisole;naphthalen-2-amine?
The InChIKey is KQXLOQFAKYVPEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C7H8O/c11-10-6-5-8-3-1-2-4-9(8)7-10;1-8-7-5-3-2-4-6-7/h1-7H,11H2;2-6H,1H3.
What are the key properties of anisole;naphthalen-2-amine?
anisole;naphthalen-2-amine has a molecular weight of 251.33 g/mol, XLogP of 4.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;naphthalen-2-amine is sourced from PubChem (CID 159214665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).