About 3-(aminomethyl)aniline;dihydrochloride
3-(aminomethyl)aniline;dihydrochloride (PubChem CID 23346995) has the molecular formula C7H12Cl2N2
and a molecular weight of 195.09 g/mol. Its IUPAC name is 3-(aminomethyl)aniline;dihydrochloride.
Molecular Properties
| Compound Name | 3-(aminomethyl)aniline;dihydrochloride |
| PubChem CID | 23346995 |
| Molecular Formula | C7H12Cl2N2 |
| Molecular Weight | 195.09 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 3-(aminomethyl)aniline;dihydrochloride |
| SMILES | Cl.Cl.NCc1cccc(N)c1 |
| InChI | InChI=1S/C7H10N2.2ClH/c8-5-6-2-1-3-7(9)4-6;;/h1-4H,5,8-9H2;2*1H |
| InChIKey | VYUNCHWZPFLDAP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.09 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(aminomethyl)aniline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)aniline;dihydrochloride?
The IUPAC name of 3-(aminomethyl)aniline;dihydrochloride (CID 23346995) is 3-(aminomethyl)aniline;dihydrochloride.
What is the SMILES notation for 3-(aminomethyl)aniline;dihydrochloride?
The canonical SMILES for 3-(aminomethyl)aniline;dihydrochloride is Cl.Cl.NCc1cccc(N)c1.
What is the InChIKey of 3-(aminomethyl)aniline;dihydrochloride?
The InChIKey is VYUNCHWZPFLDAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.2ClH/c8-5-6-2-1-3-7(9)4-6;;/h1-4H,5,8-9H2;2*1H.
What are the key properties of 3-(aminomethyl)aniline;dihydrochloride?
3-(aminomethyl)aniline;dihydrochloride has a molecular weight of 195.09 g/mol, XLogP of 1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)aniline;dihydrochloride is sourced from PubChem (CID 23346995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).