About [3-(aminomethyl)phenyl]methanamine;boric acid
[3-(aminomethyl)phenyl]methanamine;boric acid (PubChem CID 175765748) has the molecular formula C8H15BN2O3
and a molecular weight of 198.03 g/mol. Its IUPAC name is [3-(aminomethyl)phenyl]methanamine;boric acid.
Molecular Properties
| Compound Name | [3-(aminomethyl)phenyl]methanamine;boric acid |
| PubChem CID | 175765748 |
| Molecular Formula | C8H15BN2O3 |
| Molecular Weight | 198.03 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | [3-(aminomethyl)phenyl]methanamine;boric acid |
| SMILES | NCc1cccc(CN)c1.OB(O)O |
| InChI | InChI=1S/C8H12N2.BH3O3/c9-5-7-2-1-3-8(4-7)6-10;2-1(3)4/h1-4H,5-6,9-10H2;2-4H |
| InChIKey | MIWZDIAUWXOOFF-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.03 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-(aminomethyl)phenyl]methanamine;boric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(aminomethyl)phenyl]methanamine;boric acid?
The IUPAC name of [3-(aminomethyl)phenyl]methanamine;boric acid (CID 175765748) is [3-(aminomethyl)phenyl]methanamine;boric acid.
What is the SMILES notation for [3-(aminomethyl)phenyl]methanamine;boric acid?
The canonical SMILES for [3-(aminomethyl)phenyl]methanamine;boric acid is NCc1cccc(CN)c1.OB(O)O.
What is the InChIKey of [3-(aminomethyl)phenyl]methanamine;boric acid?
The InChIKey is MIWZDIAUWXOOFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.BH3O3/c9-5-7-2-1-3-8(4-7)6-10;2-1(3)4/h1-4H,5-6,9-10H2;2-4H.
What are the key properties of [3-(aminomethyl)phenyl]methanamine;boric acid?
[3-(aminomethyl)phenyl]methanamine;boric acid has a molecular weight of 198.03 g/mol, XLogP of -1.45, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(aminomethyl)phenyl]methanamine;boric acid is sourced from PubChem (CID 175765748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).