About [3-(aminomethyl)phenyl]methanamine;thiocyanic acid
[3-(aminomethyl)phenyl]methanamine;thiocyanic acid (PubChem CID 175054435) has the molecular formula C9H13N3S
and a molecular weight of 195.29 g/mol. Its IUPAC name is [3-(aminomethyl)phenyl]methanamine;thiocyanic acid.
Molecular Properties
| Compound Name | [3-(aminomethyl)phenyl]methanamine;thiocyanic acid |
| PubChem CID | 175054435 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | [3-(aminomethyl)phenyl]methanamine;thiocyanic acid |
| SMILES | N#CS.NCc1cccc(CN)c1 |
| InChI | InChI=1S/C8H12N2.CHNS/c9-5-7-2-1-3-8(4-7)6-10;2-1-3/h1-4H,5-6,9-10H2;3H |
| InChIKey | BHHBELKCMQJRTB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [3-(aminomethyl)phenyl]methanamine;thiocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(aminomethyl)phenyl]methanamine;thiocyanic acid?
The IUPAC name of [3-(aminomethyl)phenyl]methanamine;thiocyanic acid (CID 175054435) is [3-(aminomethyl)phenyl]methanamine;thiocyanic acid.
What is the SMILES notation for [3-(aminomethyl)phenyl]methanamine;thiocyanic acid?
The canonical SMILES for [3-(aminomethyl)phenyl]methanamine;thiocyanic acid is N#CS.NCc1cccc(CN)c1.
What is the InChIKey of [3-(aminomethyl)phenyl]methanamine;thiocyanic acid?
The InChIKey is BHHBELKCMQJRTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.CHNS/c9-5-7-2-1-3-8(4-7)6-10;2-1-3/h1-4H,5-6,9-10H2;3H.
What are the key properties of [3-(aminomethyl)phenyl]methanamine;thiocyanic acid?
[3-(aminomethyl)phenyl]methanamine;thiocyanic acid has a molecular weight of 195.29 g/mol, XLogP of 1.00, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(aminomethyl)phenyl]methanamine;thiocyanic acid is sourced from PubChem (CID 175054435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).