About 3-(aminomethyl)aniline;tert-butyl formate
3-(aminomethyl)aniline;tert-butyl formate (PubChem CID 174605074) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-(aminomethyl)aniline;tert-butyl formate.
Molecular Properties
| Compound Name | 3-(aminomethyl)aniline;tert-butyl formate |
| PubChem CID | 174605074 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 3-(aminomethyl)aniline;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.NCc1cccc(N)c1 |
| InChI | InChI=1S/C7H10N2.C5H10O2/c8-5-6-2-1-3-7(9)4-6;1-5(2,3)7-4-6/h1-4H,5,8-9H2;4H,1-3H3 |
| InChIKey | IYVSMZKPCLJSPD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(aminomethyl)aniline;tert-butyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)aniline;tert-butyl formate?
The IUPAC name of 3-(aminomethyl)aniline;tert-butyl formate (CID 174605074) is 3-(aminomethyl)aniline;tert-butyl formate.
What is the SMILES notation for 3-(aminomethyl)aniline;tert-butyl formate?
The canonical SMILES for 3-(aminomethyl)aniline;tert-butyl formate is CC(C)(C)OC=O.NCc1cccc(N)c1.
What is the InChIKey of 3-(aminomethyl)aniline;tert-butyl formate?
The InChIKey is IYVSMZKPCLJSPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C5H10O2/c8-5-6-2-1-3-7(9)4-6;1-5(2,3)7-4-6/h1-4H,5,8-9H2;4H,1-3H3.
What are the key properties of 3-(aminomethyl)aniline;tert-butyl formate?
3-(aminomethyl)aniline;tert-butyl formate has a molecular weight of 224.30 g/mol, XLogP of 1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)aniline;tert-butyl formate is sourced from PubChem (CID 174605074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).