C17H15BrN2O — CID 173190798
(10R)-3-benzyl-10-bromo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one (PubChem CID 173190798) has the molecular formula C17H15BrN2O and a molecular weight of 343.22 g/mol. Its IUPAC name is (10R)-3-benzyl-10-bromo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one.
| Compound Name | (10R)-3-benzyl-10-bromo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
|---|---|
| PubChem CID | 173190798 |
| Molecular Formula | C17H15BrN2O |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | (10R)-3-benzyl-10-bromo-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
| SMILES | O=c1n(Cc2ccccc2)c2cccc3c2n1C[C@H](Br)C3 |
| InChI | InChI=1S/C17H15BrN2O/c18-14-9-13-7-4-8-15-16(13)20(11-14)17(21)19(15)10-12-5-2-1-3-6-12/h1-8,14H,9-11H2/t14-/m1/s1 |
| InChIKey | AONZLZFWMLHGPA-CQSZACIVSA-N |
| XLogP | 3.17 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|