C10H10N2OS2 — CID 170541648
5-benzylimino-4-methyl-1,2,4-dithiazolidin-3-one (PubChem CID 170541648) has the molecular formula C10H10N2OS2 and a molecular weight of 238.34 g/mol. Its IUPAC name is 5-benzylimino-4-methyl-1,2,4-dithiazolidin-3-one.
| Compound Name | 5-benzylimino-4-methyl-1,2,4-dithiazolidin-3-one |
|---|---|
| PubChem CID | 170541648 |
| Molecular Formula | C10H10N2OS2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 5-benzylimino-4-methyl-1,2,4-dithiazolidin-3-one |
| SMILES | Cn1c(=O)ss/c1=N\Cc1ccccc1 |
| InChI | InChI=1S/C10H10N2OS2/c1-12-9(14-15-10(12)13)11-7-8-5-3-2-4-6-8/h2-6H,7H2,1H3/b11-9- |
| InChIKey | ZRAUNOLJAOWPHS-LUAWRHEFSA-N |
| XLogP | 1.61 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |