C18H18N4O2S — CID 15733523
(3Z)-1-benzyl-3-(2-benzyl-4-methyl-3-oxo-1,2,4-thiadiazolidin-5-ylidene)urea (PubChem CID 15733523) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is (3Z)-1-benzyl-3-(2-benzyl-4-methyl-3-oxo-1,2,4-thiadiazolidin-5-ylidene)urea.
| Compound Name | (3Z)-1-benzyl-3-(2-benzyl-4-methyl-3-oxo-1,2,4-thiadiazolidin-5-ylidene)urea |
|---|---|
| PubChem CID | 15733523 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (3Z)-1-benzyl-3-(2-benzyl-4-methyl-3-oxo-1,2,4-thiadiazolidin-5-ylidene)urea |
| SMILES | Cn1c(=O)n(Cc2ccccc2)s/c1=N\C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H18N4O2S/c1-21-17(20-16(23)19-12-14-8-4-2-5-9-14)25-22(18(21)24)13-15-10-6-3-7-11-15/h2-11H,12-13H2,1H3,(H,19,23)/b20-17- |
| InChIKey | ORKYIKRFQALZEA-JZJYNLBNSA-N |
| XLogP | 2.11 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|