C13H13N3O3 — CID 121025213
N-benzyl-3-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 121025213) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is N-benzyl-3-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-benzyl-3-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121025213 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-benzyl-3-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cn1c(=O)[nH]cc(C(=O)NCc2ccccc2)c1=O |
| InChI | InChI=1S/C13H13N3O3/c1-16-12(18)10(8-15-13(16)19)11(17)14-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,14,17)(H,15,19) |
| InChIKey | RIBSQTOLYNTALW-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |