C19H17N3O3 — CID 121025253
N-benzhydryl-3-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 121025253) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is N-benzhydryl-3-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-benzhydryl-3-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121025253 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-benzhydryl-3-methyl-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cn1c(=O)[nH]cc(C(=O)NC(c2ccccc2)c2ccccc2)c1=O |
| InChI | InChI=1S/C19H17N3O3/c1-22-18(24)15(12-20-19(22)25)17(23)21-16(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,16H,1H3,(H,20,25)(H,21,23) |
| InChIKey | YHMUURIUTKAKJF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |