C23H19N3O2 — CID 7619434
N-benzhydryl-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 7619434) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-benzhydryl-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-benzhydryl-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 7619434 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-benzhydryl-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | Cn1c(=O)c(C(=O)NC(c2ccccc2)c2ccccc2)cc2cccnc21 |
| InChI | InChI=1S/C23H19N3O2/c1-26-21-18(13-8-14-24-21)15-19(23(26)28)22(27)25-20(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-15,20H,1H3,(H,25,27) |
| InChIKey | UGRRSVOCNMQLJO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |