C12H13N3O2 — CID 7619354
N-ethyl-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 7619354) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is N-ethyl-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-ethyl-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 7619354 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | N-ethyl-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | CCNC(=O)c1cc2cccnc2n(C)c1=O |
| InChI | InChI=1S/C12H13N3O2/c1-3-13-11(16)9-7-8-5-4-6-14-10(8)15(2)12(9)17/h4-7H,3H2,1-2H3,(H,13,16) |
| InChIKey | QEXJGCBRSKQPOI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |