C14H15Cl2N3O2 — CID 7619271
N,N-bis(2-chloroethyl)-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 7619271) has the molecular formula C14H15Cl2N3O2 and a molecular weight of 328.20 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N,N-bis(2-chloroethyl)-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 7619271 |
| Molecular Formula | C14H15Cl2N3O2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N,N-bis(2-chloroethyl)-1-methyl-2-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | Cn1c(=O)c(C(=O)N(CCCl)CCCl)cc2cccnc21 |
| InChI | InChI=1S/C14H15Cl2N3O2/c1-18-12-10(3-2-6-17-12)9-11(13(18)20)14(21)19(7-4-15)8-5-16/h2-3,6,9H,4-5,7-8H2,1H3 |
| InChIKey | MCBFXGYREICIQF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|